3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol
Modify Date: 2026-07-22 18:28:33
3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol structure
|
Common Name | 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 68097-97-2 | Molecular Weight | 219.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H21NO |
|---|---|
| Molecular Weight | 219.32300 |
| Exact Mass | 219.16200 |
| PSA | 23.47000 |
| LogP | 2.93280 |
| InChIKey | NWQLKYKHRYOXOY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(CN2CCCCC2)c1O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
![Phenol,2-[(diethylamino)methyl]-3,6-dimethyl structure](https://image.chemsrc.com/caspic/475/6630-03-1.png)
CAS#:6630-03-1
CAS#:69286-57-3
CAS#:120983-08-6This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: Molecular formula of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is C14H21NO. |
| Q: What is the English name of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: The English name of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol. |
| Q: What are the downstream products of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: Related downstream products(CAS) of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol: 6630-03-1;69286-57-3;120983-08-6. |
| Q: What is the molecular weight of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: Molecular weight of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is 219.32300. |
| Q: What is the Chinese name of 68097-97-2? |
| A: Chinese name of 68097-97-2 is 68097-97-2. |
| Q: What is the InChIKey of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: InChIKey of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is NWQLKYKHRYOXOY-UHFFFAOYSA-N. |
| Q: What is the LogP of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: LogP of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is 2.93280. |
| Q: What is the polar surface area (PSA) of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: Polar surface area (PSA) of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is 23.47000. |
| Q: What is the SMILES notation of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: SMILES notation of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is Cc1ccc(C)c(CN2CCCCC2)c1O. |
| Q: What is the CAS number of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol? |
| A: CAS number of 3,6-dimethyl-2-(piperidin-1-ylmethyl)phenol is 68097-97-2. |