1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane
Modify Date: 2026-08-14 22:03:06
1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane structure
|
Common Name | 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane | ||
|---|---|---|---|---|
| CAS Number | 681-08-3 | Molecular Weight | 304.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5F12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5F12O |
|---|---|
| Molecular Weight | 304.03 |
| Exact Mass | 303.9757526 |
| PSA | 9.23000 |
| LogP | 3.49520 |
| InChIKey | WPJULLVPGWXWQS-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)(C(F)(F)F)OC(F)(F)F |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-tert-Butoxy-2,2-dichlor-1,1,2-trifluor-aethan |
| 1.1.2-Trifluor-2.2-dichlor-1-tert.-butyloxy-aethan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: SMILES notation of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is C(C(F)(F)F)(C(F)(F)F)(C(F)(F)F)OC(F)(F)F. |
| Q: What is the InChIKey of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: InChIKey of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is WPJULLVPGWXWQS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: CAS number of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is 681-08-3. |
| Q: What is the LogP of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: LogP of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is 3.49520. |
| Q: What is the English name of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: The English name of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane. |
| Q: What English synonyms does 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane have? |
| A: English synonyms of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane: 1-tert-Butoxy-2,2-dichlor-1,1,2-trifluor-aethan, 1.1.2-Trifluor-2.2-dichlor-1-tert.-butyloxy-aethan. |
| Q: What is the molecular formula of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: Molecular formula of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is C5F12O. |
| Q: What is the Chinese name of 681-08-3? |
| A: Chinese name of 681-08-3 is 681-08-3. |
| Q: What is the molecular weight of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: Molecular weight of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is 304.03. |
| Q: What is the polar surface area (PSA) of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane? |
| A: Polar surface area (PSA) of 1-tert-butoxy-2,2-dichloro-1,1,2-trifluoro-ethane is 9.23000. |