1,1,2,2-tetrafluoro-1-iodo-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethane structure
|
Common Name | 1,1,2,2-tetrafluoro-1-iodo-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethane | ||
|---|---|---|---|---|
| CAS Number | 681-30-1 | Molecular Weight | 469.83800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4F8I2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2-tetrafluoro-1-iodo-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)ethane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4F8I2O |
|---|---|
| Molecular Weight | 469.83800 |
| Exact Mass | 469.79100 |
| PSA | 9.23000 |
| LogP | 4.24420 |
| InChIKey | YKURCUVJDAMFOF-UHFFFAOYSA-N |
| SMILES | FC(F)(I)C(F)(F)OC(F)(F)C(F)(F)I |
|
~49%
1,1,2,2-tetrafl... CAS#:681-30-1 |
| Literature: Huang, Wei-Yuan; Huang, Bing-Nan; Hu, Chang-Ming Journal of Fluorine Chemistry, 1983 , vol. 23, p. 229 - 240 |
|
~%
1,1,2,2-tetrafl... CAS#:681-30-1 |
| Literature: Minnesota Mining and Mfg. Co. Patent: GB858671 , 1957 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,5-diiodo-3-oxaoctafluoropentane |