methyl 6-amino-3-bromo-2-methoxybenzoate
Modify Date: 2026-07-05 01:18:19
methyl 6-amino-3-bromo-2-methoxybenzoate structure
|
Common Name | methyl 6-amino-3-bromo-2-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 681247-48-3 | Molecular Weight | 260.08500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 6-amino-3-bromo-2-methoxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10BrNO3 |
|---|---|
| Molecular Weight | 260.08500 |
| Exact Mass | 258.98400 |
| PSA | 61.55000 |
| LogP | 2.40770 |
| InChIKey | BUNNNSIWJYZEHF-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(N)ccc(Br)c1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:681247-97-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 681247-48-3? |
| A: Chinese name of 681247-48-3 is 681247-48-3. |
| Q: What is the molecular weight of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: Molecular weight of methyl 6-amino-3-bromo-2-methoxybenzoate is 260.08500. |
| Q: What is the English name of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: The English name of methyl 6-amino-3-bromo-2-methoxybenzoate is methyl 6-amino-3-bromo-2-methoxybenzoate. |
| Q: What are the downstream products of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: Related downstream products(CAS) of methyl 6-amino-3-bromo-2-methoxybenzoate: 681247-97-2. |
| Q: What is the CAS number of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: CAS number of methyl 6-amino-3-bromo-2-methoxybenzoate is 681247-48-3. |
| Q: What is the SMILES notation of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: SMILES notation of methyl 6-amino-3-bromo-2-methoxybenzoate is COC(=O)c1c(N)ccc(Br)c1OC. |
| Q: What is the LogP of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: LogP of methyl 6-amino-3-bromo-2-methoxybenzoate is 2.40770. |
| Q: What is the InChIKey of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: InChIKey of methyl 6-amino-3-bromo-2-methoxybenzoate is BUNNNSIWJYZEHF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: Molecular formula of methyl 6-amino-3-bromo-2-methoxybenzoate is C9H10BrNO3. |
| Q: What is the polar surface area (PSA) of methyl 6-amino-3-bromo-2-methoxybenzoate? |
| A: Polar surface area (PSA) of methyl 6-amino-3-bromo-2-methoxybenzoate is 61.55000. |