7-(benzyloxy)-5-methoxy-2-phenyl-4H-chromen-4-one structure
|
Common Name | 7-(benzyloxy)-5-methoxy-2-phenyl-4H-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 681294-57-5 | Molecular Weight | 358.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-(benzyloxy)-2-hydroxy-6-methoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H18O4 |
|---|---|
| Molecular Weight | 358.38700 |
| Exact Mass | 358.12100 |
| PSA | 48.67000 |
| LogP | 5.04760 |
| InChIKey | GOTINPUMXAEBIX-UHFFFAOYSA-N |
| SMILES | COc1cc(OCc2ccccc2)cc2oc(-c3ccccc3)cc(=O)c12 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: Binding affinity to PPARdelta (unknown origin) upto 10 uM by TR-FRET-based competitiv...
Source: ChEMBL
Target: Peroxisome proliferator-activated receptor delta
External Id: CHEMBL5256680
|
|
Name: Binding affinity to PPARalpha (unknown origin) upto 10 uM by TR-FRET-based competitiv...
Source: ChEMBL
Target: Peroxisome proliferator-activated receptor alpha
External Id: CHEMBL5256679
|
| 7-benzyloxy-5-methoxy-2-phenyl-chromen-4-one |
| 7-Benzyloxy-5-methoxy-2-phenyl-chromen-4-on |