(4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone
Modify Date: 2026-07-01 23:35:45
(4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone structure
|
Common Name | (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 681470-02-0 | Molecular Weight | 301.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO5 |
|---|---|
| Molecular Weight | 301.29400 |
| Exact Mass | 301.09500 |
| PSA | 81.35000 |
| LogP | 3.67460 |
| InChIKey | COTAZRPQPCRGDF-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)c2ccc(C)cc2)c([N+](=O)[O-])cc1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:391251-83-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: Molecular formula of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is C16H15NO5. |
| Q: What is the CAS number of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: CAS number of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is 681470-02-0. |
| Q: What is the polar surface area (PSA) of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: Polar surface area (PSA) of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is 81.35000. |
| Q: What is the English name of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: The English name of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone. |
| Q: What is the molecular weight of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: Molecular weight of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is 301.29400. |
| Q: What is the Chinese name of 681470-02-0? |
| A: Chinese name of 681470-02-0 is 681470-02-0. |
| Q: What is the InChIKey of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: InChIKey of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is COTAZRPQPCRGDF-UHFFFAOYSA-N. |
| Q: What are the downstream products of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: Related downstream products(CAS) of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone: 391251-83-5. |
| Q: What is the LogP of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: LogP of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is 3.67460. |
| Q: What is the SMILES notation of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone? |
| A: SMILES notation of (4,5-dimethoxy-2-nitrophenyl)-(4-methylphenyl)methanone is COc1cc(C(=O)c2ccc(C)cc2)c([N+](=O)[O-])cc1OC. |