t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate
![t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate Structure](https://image.chemsrc.com/caspic/072/681482-18-8.png)
t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate structure
|
Common Name | t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 681482-18-8 | Molecular Weight | 338.44300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H26N2O2 |
|---|---|
| Molecular Weight | 338.44300 |
| Exact Mass | 338.19900 |
| PSA | 32.78000 |
| LogP | 4.41360 |
| InChIKey | RVWANLFCJIYHGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(-c3ccccc3)cc2)CC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:180698-19-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl 4-(4-biphenylyl)piperazine-1-carboxylate |
| tert-butyl 4-(biphenyl-4-yl)piperazine-1-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: The English name of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate is t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate. |
| Q: What English synonyms does t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate have? |
| A: English synonyms of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate: tert-butyl 4-(4-biphenylyl)piperazine-1-carboxylate, tert-butyl 4-(biphenyl-4-yl)piperazine-1-carboxylate. |
| Q: What is the LogP of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: LogP of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate is 4.41360. |
| Q: What is the polar surface area (PSA) of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: Polar surface area (PSA) of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate is 32.78000. |
| Q: What is the CAS number of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: CAS number of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate is 681482-18-8. |
| Q: What is the molecular formula of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: Molecular formula of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate is C21H26N2O2. |
| Q: What are the downstream products of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: Related downstream products(CAS) of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate: 180698-19-5. |
| Q: What is the molecular weight of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: Molecular weight of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate is 338.44300. |
| Q: What is the SMILES notation of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate? |
| A: SMILES notation of t-butyl 4-([1,1'-biphenyl]-4-yl)piperazine-1-carboxylate is CC(C)(C)OC(=O)N1CCN(c2ccc(-c3ccccc3)cc2)CC1. |
| Q: What is the Chinese name of 681482-18-8? |
| A: Chinese name of 681482-18-8 is 681482-18-8. |