(R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate
Modify Date: 2026-07-19 14:51:07
(R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate structure
|
Common Name | (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 681490-92-6 | Molecular Weight | 313.71500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12ClN3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H12ClN3O6S |
|---|---|
| Molecular Weight | 313.71500 |
| Exact Mass | 313.01400 |
| PSA | 135.62000 |
| LogP | 1.77590 |
| InChIKey | INLLNAMLKDKKKW-MRVPVSSYSA-N |
| SMILES | CC(O)(COS(C)(=O)=O)Cn1cc([N+](=O)[O-])nc1Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:681490-93-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: Molecular weight of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is 313.71500. |
| Q: What is the Chinese name of 681490-92-6? |
| A: Chinese name of 681490-92-6 is 681490-92-6. |
| Q: What are the downstream products of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: Related downstream products(CAS) of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate: 681490-93-7. |
| Q: What is the SMILES notation of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: SMILES notation of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is CC(O)(COS(C)(=O)=O)Cn1cc([N+](=O)[O-])nc1Cl. |
| Q: What is the English name of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: The English name of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate. |
| Q: What is the CAS number of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: CAS number of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is 681490-92-6. |
| Q: What is the molecular formula of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: Molecular formula of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is C8H12ClN3O6S. |
| Q: What is the LogP of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: LogP of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is 1.77590. |
| Q: What is the InChIKey of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: InChIKey of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is INLLNAMLKDKKKW-MRVPVSSYSA-N. |
| Q: What is the polar surface area (PSA) of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate? |
| A: Polar surface area (PSA) of (R)-3-(2-chloro-4-nitro-1H-imidazol-1-yl)-2-hydroxy-2-methylpropyl methanesulfonate is 135.62000. |