Phenol,4-chloro-3-methyl-2-nitro- structure
|
Common Name | Phenol,4-chloro-3-methyl-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6815-42-5 | Molecular Weight | 187.58000 | |
| Density | 1.466g/cm3 | Boiling Point | 256.2ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.7ºC | |
| Name | 4-chloro-3-methyl-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 256.2ºC at 760 mmHg |
| Molecular Formula | C7H6ClNO3 |
| Molecular Weight | 187.58000 |
| Flash Point | 108.7ºC |
| Exact Mass | 187.00400 |
| PSA | 66.05000 |
| LogP | 2.78540 |
| Index of Refraction | 1.61 |
| InChIKey | CPLAVZOCFVGOGO-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)ccc(O)c1[N+](=O)[O-] |
|
~%
Phenol,4-chloro... CAS#:6815-42-5 |
| Literature: Clewley, Robin G.; Cross, Gordon G.; Fischer, Alfred; Henderson, George N. Tetrahedron, 1989 , vol. 45, # 5 p. 1299 - 1310 |
|
~11%
Phenol,4-chloro... CAS#:6815-42-5 |
| Literature: Aridoss, Gopalakrishnan; Laali, Kenneth K. Journal of Organic Chemistry, 2011 , vol. 76, # 19 p. 8088 - 8094 |
|
~%
Phenol,4-chloro... CAS#:6815-42-5 |
| Literature: Clewley, Robin G.; Cross, Gordon G.; Fischer, Alfred; Henderson, George N. Tetrahedron, 1989 , vol. 45, # 5 p. 1299 - 1310 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-chloro-3-methyl-2-nitro-phenol |
| 2-Nitro-4-chlor-m-kresol |
| 4-Chlor-3-methyl-2-nitro-phenol |
| 4-chloro-2-nitro-m-cresol |