2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-bromoethyl)-5-pentyl- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-(2-bromoethyl)-5-pentyl- | ||
|---|---|---|---|---|
| CAS Number | 68160-53-2 | Molecular Weight | 305.16800 | |
| Density | 1.36g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H17BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-bromoethyl)-5-pentyl-1,3-diazinane-2,4,6-trione |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Molecular Formula | C11H17BrN2O3 |
| Molecular Weight | 305.16800 |
| Exact Mass | 304.04200 |
| PSA | 75.27000 |
| LogP | 2.36170 |
| Index of Refraction | 1.497 |
| InChIKey | MFVVZSCCIBNTIU-UHFFFAOYSA-N |
| SMILES | CCCCCC1(CCBr)C(=O)NC(=O)NC1=O |
|
~%
2,4,6(1H,3H,5H)... CAS#:68160-53-2 |
| Literature: Skinner; Bicking Journal of the American Chemical Society, 1950 , vol. 72, p. 1140 |
|
~%
2,4,6(1H,3H,5H)... CAS#:68160-53-2 |
| Literature: Skinner; Bicking Journal of the American Chemical Society, 1950 , vol. 72, p. 1140 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |