N-[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]-4-phenyl-1,3-thiazol-2-amine structure
|
Common Name | N-[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]-4-phenyl-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 68173-79-5 | Molecular Weight | 425.56800 | |
| Density | 1.286g/cm3 | Boiling Point | 640.6ºC at 760 mmHg | |
| Molecular Formula | C25H19N3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.2ºC | |
| Name | N-[4-(2-benzyl-1,3-thiazol-4-yl)phenyl]-4-phenyl-1,3-thiazol-2-amine |
|---|
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 640.6ºC at 760 mmHg |
| Molecular Formula | C25H19N3S2 |
| Molecular Weight | 425.56800 |
| Flash Point | 341.2ºC |
| Exact Mass | 425.10200 |
| PSA | 94.29000 |
| LogP | 7.34100 |
| Index of Refraction | 1.694 |
| InChIKey | BBSDFBZZVLTMAO-UHFFFAOYSA-N |
| SMILES | c1ccc(Cc2nc(-c3ccc(Nc4nc(-c5ccccc5)cs4)cc3)cs2)cc1 |
|
~%
N-[4-(2-benzyl-... CAS#:68173-79-5 |
| Literature: Sawhney,S.N. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1978 , vol. 16, p. 521 - 523 |
|
~%
N-[4-(2-benzyl-... CAS#:68173-79-5 |
| Literature: Sawhney,S.N. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1978 , vol. 16, p. 521 - 523 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |