Ethyl 1-((Tert-Butoxycarbonyl)Amino)-2-Vinylcyclopropanecarboxylate
Ethyl 1-((Tert-Butoxycarbonyl)Amino)-2-Vinylcyclopropanecarboxylate structure
|
Common Name | Ethyl 1-((Tert-Butoxycarbonyl)Amino)-2-Vinylcyclopropanecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 681807-59-0 | Molecular Weight | 255.310 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 328.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.4±27.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.4±42.0 °C at 760 mmHg |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.310 |
| Flash Point | 152.4±27.9 °C |
| Exact Mass | 255.147064 |
| PSA | 64.63000 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.484 |
| InChIKey | MUWAMLYKLZSGPE-UHFFFAOYSA-N |
| SMILES | C=CC1CC1(NC(=O)OC(C)(C)C)C(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Ethyl 1-((Tert-... CAS#:681807-59-0 |
| Literature: US2008/14173 A1, ; Page/Page column 21 ; US 20080014173 A1 |
|
~%
Ethyl 1-((Tert-... CAS#:681807-59-0 |
| Literature: US2006/183694 A1, ; Page/Page column 35-36 ; US 20060183694 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 3 | |
CAS#:259214-55-6
CAS#:259217-95-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Cyclopropanecarboxylic acid,1-[[(1,1-dimethylethoxy)carbonyl]amino]-2-ethenyl-,ethyl ester |
| racemic N-Boc-(1R,2S)/(1S,2R)-1-amino-2-vinylcyclopropane carboxylic acid ethyl ester |
| Cyclopropanecarboxylic acid, 1-[[(1,1-dimethylethoxy)carbonyl]amino]-2-ethenyl-, ethyl ester |
| (1R,2S)-ethyl 1-(tert-butoxycarbonylamino)-2-vinylcyclopropanecarboxylate |
| ethyl 1-[(tert-butoxycarbonyl)amino]-2-vinylcyclopropanecarboxylate |
| (1R,2S)/(1S,2R) N-Boc-1-amino-2-vinylcyclopropane carboxylic acid ethyl ester |
| Ethyl-1-[(tert-butoxycarbonyl)amino]-2-vinylcyclopropancarboxylat |
| Ethyl 2-[(tert-butoxycarbonyl)aMino]-3-vinylcyclopropanecarboxylate |
| N-Boc-(1R,2S)/(1S,2R)-1-amino-2-vinylcyclopropane carboxylic acid ethyl ester |
| Ethyl 1-(tert-butoxycarbonyla |
| Ethyl 1-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-2-vinylcyclopropanecarboxylate |
| Ethyl 1-(tert-butoxycarbonylamino)-2-vinylcyclopropanecarboxylate |
| 1-tert-ButoxycarbonylaMino-2-vinyl-cyclopropanecarboxylic acid Methyl ester |
| 1-TERT-BUTOXYCARBONYLAMINO-2-VINYL-CYCLOPROPANECARBOXYLIC ACID ETHYL ESTER |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: LogP of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is 2.78. |
| Q: What is the CAS number of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: CAS number of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is 681807-59-0. |
| Q: What are the downstream products of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: Related downstream products(CAS) of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester: 259214-55-6;259217-95-3;681807-60-3. |
| Q: What is the molecular formula of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: Molecular formula of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is C13H21NO4. |
| Q: What is the molecular weight of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: Molecular weight of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is 255.310. |
| Q: What is the InChIKey of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: InChIKey of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is MUWAMLYKLZSGPE-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: Polar surface area (PSA) of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is 64.63000. |
| Q: What are the upstream materials of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: Related upstream materials(CAS) of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester: 681807-60-3;24424-99-5;787548-29-2. |
| Q: What is the SMILES notation of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: SMILES notation of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is C=CC1CC1(NC(=O)OC(C)(C)C)C(=O)OCC. |
| Q: What is the boiling point of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester? |
| A: Boiling point of 1-boc-amino-2-vinylcyclopropanecarboxylic acid ethyl ester is 328.4±42.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |