4-t-butylphenyl trimethylsilyl ketone
Modify Date: 2026-06-30 15:29:01
4-t-butylphenyl trimethylsilyl ketone structure
|
Common Name | 4-t-butylphenyl trimethylsilyl ketone | ||
|---|---|---|---|---|
| CAS Number | 68185-96-6 | Molecular Weight | 234.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-t-butylphenyl trimethylsilyl ketone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H22OSi |
|---|---|
| Molecular Weight | 234.40900 |
| Exact Mass | 234.14400 |
| PSA | 17.07000 |
| LogP | 4.04420 |
| InChIKey | BRKYSDRCSPFKGV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)[Si](C)(C)C)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:1350851-19-2
CAS#:76471-78-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-t-butylphenyl trimethylsilyl ketone? |
| A: Molecular weight of 4-t-butylphenyl trimethylsilyl ketone is 234.40900. |
| Q: What is the Chinese name of 68185-96-6? |
| A: Chinese name of 68185-96-6 is 68185-96-6. |
| Q: What is the SMILES notation of 4-t-butylphenyl trimethylsilyl ketone? |
| A: SMILES notation of 4-t-butylphenyl trimethylsilyl ketone is CC(C)(C)c1ccc(C(=O)[Si](C)(C)C)cc1. |
| Q: What is the LogP of 4-t-butylphenyl trimethylsilyl ketone? |
| A: LogP of 4-t-butylphenyl trimethylsilyl ketone is 4.04420. |
| Q: What is the English name of 4-t-butylphenyl trimethylsilyl ketone? |
| A: The English name of 4-t-butylphenyl trimethylsilyl ketone is 4-t-butylphenyl trimethylsilyl ketone. |
| Q: What is the polar surface area (PSA) of 4-t-butylphenyl trimethylsilyl ketone? |
| A: Polar surface area (PSA) of 4-t-butylphenyl trimethylsilyl ketone is 17.07000. |
| Q: What is the InChIKey of 4-t-butylphenyl trimethylsilyl ketone? |
| A: InChIKey of 4-t-butylphenyl trimethylsilyl ketone is BRKYSDRCSPFKGV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 4-t-butylphenyl trimethylsilyl ketone? |
| A: Molecular formula of 4-t-butylphenyl trimethylsilyl ketone is C14H22OSi. |
| Q: What is the CAS number of 4-t-butylphenyl trimethylsilyl ketone? |
| A: CAS number of 4-t-butylphenyl trimethylsilyl ketone is 68185-96-6. |
| Q: What are the downstream products of 4-t-butylphenyl trimethylsilyl ketone? |
| A: Related downstream products(CAS) of 4-t-butylphenyl trimethylsilyl ketone: 1350851-19-2;76471-78-8. |