(3-chlorophenyl)(trimethylsilyl)methanone
Modify Date: 2026-08-21 17:34:44
(3-chlorophenyl)(trimethylsilyl)methanone structure
|
Common Name | (3-chlorophenyl)(trimethylsilyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 68185-97-7 | Molecular Weight | 212.74800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3-chlorophenyl)(trimethylsilyl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13ClOSi |
|---|---|
| Molecular Weight | 212.74800 |
| Exact Mass | 212.04200 |
| PSA | 17.07000 |
| LogP | 3.40010 |
| InChIKey | OVUXLKOGGNUXTO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(=O)c1cccc(Cl)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
![1-chloro-3-[2-(3-chlorophenyl)ethenyl]benzene structure](https://image.chemsrc.com/caspic/487/20101-53-5.png)
CAS#:20101-53-5
CAS#:587-04-2
CAS#:1066-40-6This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: Molecular weight of (3-chlorophenyl)(trimethylsilyl)methanone is 212.74800. |
| Q: What are the downstream products of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: Related downstream products(CAS) of (3-chlorophenyl)(trimethylsilyl)methanone: 20101-53-5;587-04-2;1066-40-6. |
| Q: What is the CAS number of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: CAS number of (3-chlorophenyl)(trimethylsilyl)methanone is 68185-97-7. |
| Q: What is the SMILES notation of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: SMILES notation of (3-chlorophenyl)(trimethylsilyl)methanone is C[Si](C)(C)C(=O)c1cccc(Cl)c1. |
| Q: What is the InChIKey of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: InChIKey of (3-chlorophenyl)(trimethylsilyl)methanone is OVUXLKOGGNUXTO-UHFFFAOYSA-N. |
| Q: What is the English name of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: The English name of (3-chlorophenyl)(trimethylsilyl)methanone is (3-chlorophenyl)(trimethylsilyl)methanone. |
| Q: What is the molecular formula of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: Molecular formula of (3-chlorophenyl)(trimethylsilyl)methanone is C10H13ClOSi. |
| Q: What is the polar surface area (PSA) of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: Polar surface area (PSA) of (3-chlorophenyl)(trimethylsilyl)methanone is 17.07000. |
| Q: What is the Chinese name of 68185-97-7? |
| A: Chinese name of 68185-97-7 is 68185-97-7. |
| Q: What is the LogP of (3-chlorophenyl)(trimethylsilyl)methanone? |
| A: LogP of (3-chlorophenyl)(trimethylsilyl)methanone is 3.40010. |