phenol, compound with 1,1',1''-nitrilotris[propan-2-ol] (1:1) structure
|
Common Name | phenol, compound with 1,1',1''-nitrilotris[propan-2-ol] (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68213-79-6 | Molecular Weight | 285.37900 | |
| Density | N/A | Boiling Point | 296.4ºC at 760 mmHg | |
| Molecular Formula | C15H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167ºC | |
| Name | 1-[bis(2-hydroxypropyl)amino]propan-2-ol,phenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 296.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.37900 |
| Flash Point | 167ºC |
| Exact Mass | 285.19400 |
| PSA | 84.16000 |
| LogP | 0.82300 |
| InChIKey | ZMXIHDNKGZUANT-UHFFFAOYSA-N |
| SMILES | CC(O)CN(CC(C)O)CC(C)O.Oc1ccccc1 |
| Phenol,triisopropanolamine salt |
| Triisopropanolamine phenolate |
| EINECS 269-264-4 |