ethenyl acetate,furan-2,5-dione,prop-2-enoic acid structure
|
Common Name | ethenyl acetate,furan-2,5-dione,prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 68227-02-1 | Molecular Weight | 256.20900 | |
| Density | N/A | Boiling Point | 202ºC at 760mmHg | |
| Molecular Formula | C11H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.3ºC | |
| Name | ethenyl acetate,furan-2,5-dione,prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 202ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H12O7 |
| Molecular Weight | 256.20900 |
| Flash Point | 103.3ºC |
| Exact Mass | 256.05800 |
| PSA | 106.97000 |
| LogP | 0.57600 |
| InChIKey | DOEVBVUDLFZBTI-UHFFFAOYSA-N |
| SMILES | C=CC(=O)O.C=COC(C)=O.O=C1C=CC(=O)O1 |
| 2-Propenoic acid,polymer with ethenyl acetate and 2,5-furandione |
| Acrylic acid,maleic anhydride,vinyl acetate polymer |