1H-Benzotriazole,5-chloro-1-(cyclopentyloxy)- structure
|
Common Name | 1H-Benzotriazole,5-chloro-1-(cyclopentyloxy)- | ||
|---|---|---|---|---|
| CAS Number | 68230-00-2 | Molecular Weight | 237.68500 | |
| Density | 1.48g/cm3 | Boiling Point | 367.6ºC at 760mmHg | |
| Molecular Formula | C11H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.1ºC | |
| Name | 5-chloro-1-cyclopentyloxybenzotriazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 367.6ºC at 760mmHg |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.68500 |
| Flash Point | 176.1ºC |
| Exact Mass | 237.06700 |
| PSA | 39.94000 |
| LogP | 2.45590 |
| Index of Refraction | 1.696 |
| InChIKey | HZPKEEDSMBULBU-UHFFFAOYSA-N |
| SMILES | Clc1ccc2c(c1)nnn2OC1CCCC1 |
|
~%
1H-Benzotriazol... CAS#:68230-00-2 |
| Literature: Feld, W. A.; Serve, M. P. Journal of Heterocyclic Chemistry, 1980 , vol. 17, p. 825 - 827 |
| 5-chloro-1-cyclopentyloxy-1H-benzotriazole |
| 1-Cyclopentoxy-5-chloro-1,2,3-benzotriazole |
| 5-Chloro-1-cyclopentyloxy-1,2,3-benzotriazol |