ethene,3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene,1,1,2,2-tetrafluoroethene structure
|
Common Name | ethene,3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene,1,1,2,2-tetrafluoroethene | ||
|---|---|---|---|---|
| CAS Number | 68258-85-5 | Molecular Weight | 374.14200 | |
| Density | N/A | Boiling Point | 47.7ºC at 760 mmHg | |
| Molecular Formula | C10H7F13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethene,3,3,4,4,5,5,6,6,6-nonafluorohex-1-ene,1,1,2,2-tetrafluoroethene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 47.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H7F13 |
| Molecular Weight | 374.14200 |
| Exact Mass | 374.03400 |
| LogP | 6.43380 |
| InChIKey | XSPFSRILRCQVRO-UHFFFAOYSA-N |
| SMILES | C=C.C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.FC(F)=C(F)F |
| 1-Hexene,3,3,4,4,5,5,6,6,6-nonafluoro-,polymer with ethene and 1,1,2,2-tetrafluoroethene |
| 1,1,2,2-tetrafluoroethylene |
| 1-Hexene,3,3,4,4,5,5,6,6,6-nonafluoro-,polymer with ethene and tetrafluoroethene |