Phorbasterone A
Modify Date: 2026-05-08 05:40:02
Phorbasterone A structure
|
Common Name | Phorbasterone A | ||
|---|---|---|---|---|
| CAS Number | 682808-87-3 | Molecular Weight | 456.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phorbasterone A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C29H44O4 |
|---|---|
| Molecular Weight | 456.7 |
| InChIKey | ICVWSINXYBAOLU-WXSMQYFOSA-N |
| SMILES | C[C@H](/C=C/C(C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(C[C@](C4=O)(C(=O)OC)O)C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human HCT116 cells after 72 hrs by MTS assay
Source: ChEMBL
Target: HCT-116
External Id: CHEMBL1013324
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Phorbasterone A? |
| A: Molecular formula of Phorbasterone A is C29H44O4. |
| Q: What is the Chinese name of 682808-87-3? |
| A: Chinese name of 682808-87-3 is 682808-87-3. |
| Q: What is the English name of Phorbasterone A? |
| A: The English name of Phorbasterone A is Phorbasterone A. |
| Q: What is the CAS number of Phorbasterone A? |
| A: CAS number of Phorbasterone A is 682808-87-3. |
| Q: What is the molecular weight of Phorbasterone A? |
| A: Molecular weight of Phorbasterone A is 456.7. |
| Q: What is the InChIKey of Phorbasterone A? |
| A: InChIKey of Phorbasterone A is ICVWSINXYBAOLU-WXSMQYFOSA-N. |
| Q: What is the SMILES notation of Phorbasterone A? |
| A: SMILES notation of Phorbasterone A is C[C@H](/C=C/C(C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(C[C@](C4=O)(C(=O)OC)O)C)C. |