Phosphinic acid,P,P-dioctyl
Phosphinic acid,P,P-dioctyl structure
|
Common Name | Phosphinic acid,P,P-dioctyl | ||
|---|---|---|---|---|
| CAS Number | 683-19-2 | Molecular Weight | 290.42200 | |
| Density | 0.924g/cm3 | Boiling Point | 445.7ºC at 760 mmHg | |
| Molecular Formula | C16H35O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.3ºC | |
Summary: Dioctylphosphinic acid, Chinese name: 二辛基膦酸, CAS number: 683-19-2, molecular formula: C16H35O2P, molecular weight: 290.42200, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dioctylphosphinic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.924g/cm3 |
|---|---|
| Boiling Point | 445.7ºC at 760 mmHg |
| Molecular Formula | C16H35O2P |
| Molecular Weight | 290.42200 |
| Flash Point | 223.3ºC |
| Exact Mass | 290.23700 |
| PSA | 47.11000 |
| LogP | 5.97780 |
| Index of Refraction | 1.45 |
| InChIKey | YTMRJBAHYSIRMZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCP(=O)(O)CCCCCCCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2915900090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 1 | |
CAS#:3011-82-3
CAS#:111-66-0
CAS#:56-23-5
CAS#:34045-17-5
CAS#:4731-53-7
CAS#:629-27-6
CAS#:111-83-1
CAS#:17049-49-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bis-n-octylphosphinic acid |
| dioctyl-phosphinic acid |
| phosphinic acid,p,p-dioctyl |
| di-n-octylphosphinic acid |
| n-octyl2P(O)OH |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of dioctylphosphinic acid? |
| A: Related upstream materials(CAS) of dioctylphosphinic acid: 3011-82-3;111-66-0;56-23-5;34045-17-5;4731-53-7;629-27-6;111-83-1;17049-49-9. |
| Q: What is the InChIKey of dioctylphosphinic acid? |
| A: InChIKey of dioctylphosphinic acid is YTMRJBAHYSIRMZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 683-19-2? |
| A: Chinese name of 683-19-2 is 683-19-2. |
| Q: What English synonyms does dioctylphosphinic acid have? |
| A: English synonyms of dioctylphosphinic acid: bis-n-octylphosphinic acid, dioctyl-phosphinic acid, phosphinic acid,p,p-dioctyl, di-n-octylphosphinic acid, n-octyl2P(O)OH. |
| Q: What is the boiling point of dioctylphosphinic acid? |
| A: Boiling point of dioctylphosphinic acid is 445.7ºC at 760 mmHg. |
| Q: What is the LogP of dioctylphosphinic acid? |
| A: LogP of dioctylphosphinic acid is 5.97780. |
| Q: What is the English name of dioctylphosphinic acid? |
| A: The English name of dioctylphosphinic acid is dioctylphosphinic acid. |
| Q: What is the SMILES notation of dioctylphosphinic acid? |
| A: SMILES notation of dioctylphosphinic acid is CCCCCCCCP(=O)(O)CCCCCCCC. |
| Q: What is the polar surface area (PSA) of dioctylphosphinic acid? |
| A: Polar surface area (PSA) of dioctylphosphinic acid is 47.11000. |
| Q: What is the molecular weight of dioctylphosphinic acid? |
| A: Molecular weight of dioctylphosphinic acid is 290.42200. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |