2-bromo-1-(5-chloro-2-methoxy-4-methylphenyl)ethanone structure
|
Common Name | 2-bromo-1-(5-chloro-2-methoxy-4-methylphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 683274-74-0 | Molecular Weight | 277.54200 | |
| Density | 1.489g/cm3 | Boiling Point | 350.7ºC at 760 mmHg | |
| Molecular Formula | C10H10BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9ºC | |
| Name | 2-bromo-1-(5-chloro-2-methoxy-4-methylphenyl)ethanone |
|---|
| Density | 1.489g/cm3 |
|---|---|
| Boiling Point | 350.7ºC at 760 mmHg |
| Molecular Formula | C10H10BrClO2 |
| Molecular Weight | 277.54200 |
| Flash Point | 165.9ºC |
| Exact Mass | 275.95500 |
| PSA | 26.30000 |
| LogP | 3.23460 |
| Index of Refraction | 1.561 |
| InChIKey | BYBYETVLFBNBBH-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(Cl)cc1C(=O)CBr |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |