methyl 7-(4-methyl-3,5-dioxo-1,2,4-triazolidin-1-yl)heptanoate structure
|
Common Name | methyl 7-(4-methyl-3,5-dioxo-1,2,4-triazolidin-1-yl)heptanoate | ||
|---|---|---|---|---|
| CAS Number | 68329-17-9 | Molecular Weight | 257.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 7-(4-methyl-3,5-dioxo-1,2,4-triazolidin-1-yl)heptanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H19N3O4 |
|---|---|
| Molecular Weight | 257.28600 |
| Exact Mass | 257.13800 |
| PSA | 86.35000 |
| LogP | 0.41090 |
| InChIKey | KKNDTZFBTQUCMB-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCCn1[nH]c(=O)n(C)c1=O |
|
~10%
methyl 7-(4-met... CAS#:68329-17-9 |
| Literature: Adams, David R.; Barnes, Alan F.; Cassidy, Frederick; Thompson, Mervyn Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , p. 2061 - 2068 |
|
~%
methyl 7-(4-met... CAS#:68329-17-9 |
| Literature: Beecham Group Limited Patent: US4367338 A1, 1983 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,2,4-Triazolidine-1-heptanoic acid,4-methyl-3,5-dioxo-,methyl ester |