3-(2,4-dichloro-5-methyl-phenoxy)butan-2-one structure
|
Common Name | 3-(2,4-dichloro-5-methyl-phenoxy)butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 6834-33-9 | Molecular Weight | 247.11800 | |
| Density | 1.231g/cm3 | Boiling Point | 331.1ºC at 760 mmHg | |
| Molecular Formula | C11H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.3ºC | |
| Name | 3-(2,4-dichloro-5-methylphenoxy)butan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 331.1ºC at 760 mmHg |
| Molecular Formula | C11H12Cl2O2 |
| Molecular Weight | 247.11800 |
| Flash Point | 133.3ºC |
| Exact Mass | 246.02100 |
| PSA | 26.30000 |
| LogP | 3.65810 |
| Index of Refraction | 1.524 |
| InChIKey | XCGFDHLHFKCYQG-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)Oc1cc(C)c(Cl)cc1Cl |
|
~%
3-(2,4-dichloro... CAS#:6834-33-9 |
| Literature: Brust,D.P. et al. Journal of Organic Chemistry, 1966 , vol. 31, p. 2192 - 2201 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(2,4-Dichlor-5-methyl-phenoxy)-butan-2-on |