1,5-dichloro-2-methyl-4-(2-methylprop-2-enoxy)benzene
Modify Date: 2025-08-26 15:49:43
1,5-dichloro-2-methyl-4-(2-methylprop-2-enoxy)benzene structure
|
Common Name | 1,5-dichloro-2-methyl-4-(2-methylprop-2-enoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 6834-36-2 | Molecular Weight | 231.11800 | |
| Density | 1.167g/cm3 | Boiling Point | 305.5ºC at 760 mmHg | |
| Molecular Formula | C11H12Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85ºC | |
| Name | 1,5-dichloro-2-methyl-4-(2-methylprop-2-enoxy)benzene |
|---|
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 305.5ºC at 760 mmHg |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.11800 |
| Flash Point | 85ºC |
| Exact Mass | 230.02700 |
| PSA | 9.23000 |
| LogP | 4.25670 |
| Index of Refraction | 1.528 |
| InChIKey | LIFPLABERBHBGF-UHFFFAOYSA-N |
| SMILES | C=C(C)COc1cc(C)c(Cl)cc1Cl |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:6834-37-3|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1