benzene-1,2,4-tricarboxylic acid, compound with 2-phenyl-1H-imidazole-1-propiononitrile structure
|
Common Name | benzene-1,2,4-tricarboxylic acid, compound with 2-phenyl-1H-imidazole-1-propiononitrile | ||
|---|---|---|---|---|
| CAS Number | 68340-26-1 | Molecular Weight | 407.37600 | |
| Density | N/A | Boiling Point | 418.3ºC at 760mmHg | |
| Molecular Formula | C21H17N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.8ºC | |
| Name | benzene-1,2,4-tricarboxylic acid,3-(2-phenylimidazol-1-yl)propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 418.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C21H17N3O6 |
| Molecular Weight | 407.37600 |
| Flash Point | 206.8ºC |
| Exact Mass | 407.11200 |
| PSA | 153.51000 |
| LogP | 3.24498 |
| InChIKey | GNLIGJLHRCFSDF-UHFFFAOYSA-N |
| SMILES | N#CCCn1ccnc1-c1ccccc1.O=C(O)c1ccc(C(=O)O)c(C(=O)O)c1 |
| Benzene-1,2,4-tricarboxylic acid,compound with 2-phenyl-1H-imidazole-1-propiononitrile |
| EINECS 269-846-8 |