CID 82264256
Modify Date: 2026-08-16 16:59:10
CID 82264256 structure
|
Common Name | CID 82264256 | ||
|---|---|---|---|---|
| CAS Number | 6836-90-4 | Molecular Weight | 204.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 82264256 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12O3 |
|---|---|
| Molecular Weight | 204.22 |
| InChIKey | FAXJXLQLGZGARO-UHFFFAOYSA-N |
| SMILES | Cc1c(CCC(=O)O)oc2ccccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of CID 82264256? |
| A: SMILES notation of CID 82264256 is Cc1c(CCC(=O)O)oc2ccccc12. |
| Q: What is the InChIKey of CID 82264256? |
| A: InChIKey of CID 82264256 is FAXJXLQLGZGARO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of CID 82264256? |
| A: Molecular formula of CID 82264256 is C12H12O3. |
| Q: What is the Chinese name of 6836-90-4? |
| A: Chinese name of 6836-90-4 is 6836-90-4. |
| Q: What is the CAS number of CID 82264256? |
| A: CAS number of CID 82264256 is 6836-90-4. |
| Q: What is the English name of CID 82264256? |
| A: The English name of CID 82264256 is CID 82264256. |
| Q: What is the molecular weight of CID 82264256? |
| A: Molecular weight of CID 82264256 is 204.22. |