4-ethoxy-5-hydroxynaphthalene-2,7-disulphonic acid structure
|
Common Name | 4-ethoxy-5-hydroxynaphthalene-2,7-disulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6837-94-1 | Molecular Weight | 348.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethoxy-5-hydroxynaphthalene-2,7-disulphonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O8S2 |
|---|---|
| Molecular Weight | 348.34900 |
| Exact Mass | 347.99700 |
| PSA | 154.96000 |
| LogP | 3.59910 |
| InChIKey | LCGZDSZETRKQQN-UHFFFAOYSA-N |
| SMILES | CCOc1cc(S(=O)(=O)O)cc2cc(S(=O)(=O)O)cc(O)c12 |
| HS Code | 2909500000 |
|---|
|
~%
4-ethoxy-5-hydr... CAS#:6837-94-1 |
| Literature: Bayer and Co. Patent: DE73741 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 470 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Einecs 229-923-9 |
| 4-ethoxy-5-hydroxy-naphthalene-2,7-disulfonic acid |
| 4-Ethoxy-5-hydroxy-2,7-naphthalenedisulfonic acid |
| 4-Aethoxy-5-hydroxy-naphthalin-2,7-disulfonsaeure |
| 8-ethoxy-1-naphthol-3,6-disulfonic acid |