N,1-dimethyl-N-prop-2-enylindole-2-carboxamide structure
|
Common Name | N,1-dimethyl-N-prop-2-enylindole-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 683800-12-6 | Molecular Weight | 228.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,1-dimethyl-N-prop-2-enylindole-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O |
|---|---|
| Molecular Weight | 228.29000 |
| Exact Mass | 228.12600 |
| PSA | 25.24000 |
| LogP | 2.43630 |
| InChIKey | OVMOZUFWAOCFOP-UHFFFAOYSA-N |
| SMILES | C=CCN(C)C(=O)c1cc2ccccc2n1C |
|
~%
N,1-dimethyl-N-... CAS#:683800-12-6 |
| Literature: Liu, Cong; Han, Xiaoqing; Wang, Xiang; Widenhoefer, Ross A. Journal of the American Chemical Society, 2004 , vol. 126, # 12 p. 3700 - 3701 |
|
~%
N,1-dimethyl-N-... CAS#:683800-12-6 |
| Literature: Liu, Cong; Han, Xiaoqing; Wang, Xiang; Widenhoefer, Ross A. Journal of the American Chemical Society, 2004 , vol. 126, # 12 p. 3700 - 3701 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-allyl-N-methyl-1-methyl-1H-indole-2-carboxamide |
| N-allyl-N-methyl-1-methylindole-2-carboxamide |
| 1H-Indole-2-carboxamide,N,1-dimethyl-N-2-propenyl |