5-methoxy-2-pent-4-enyl-1H-indole structure
|
Common Name | 5-methoxy-2-pent-4-enyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 683800-27-3 | Molecular Weight | 215.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methoxy-2-pent-4-enyl-1H-indole |
|---|
| Molecular Formula | C14H17NO |
|---|---|
| Molecular Weight | 215.29100 |
| Exact Mass | 215.13100 |
| PSA | 25.02000 |
| LogP | 3.68520 |
| InChIKey | QXCXGGFMPIFYCE-UHFFFAOYSA-N |
| SMILES | C=CCCCc1cc2cc(OC)ccc2[nH]1 |
|
~29%
5-methoxy-2-pen... CAS#:683800-27-3 |
| Literature: Liu, Cong; Han, Xiaoqing; Wang, Xiang; Widenhoefer, Ross A. Journal of the American Chemical Society, 2004 , vol. 126, # 12 p. 3700 - 3701 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |