formic acid, compound with [2-[2-[[4-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]phenyl]sulphonyl]ethoxy]propyl]dimethylamine (1:1) structure
|
Common Name | formic acid, compound with [2-[2-[[4-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-1-yl]phenyl]sulphonyl]ethoxy]propyl]dimethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68400-01-1 | Molecular Weight | 496.01900 | |
| Density | N/A | Boiling Point | 604.6ºC at 760 mmHg | |
| Molecular Formula | C23H30ClN3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.5ºC | |
| Name | 2-[2-[4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]phenyl]sulfonylethoxy]-N,N-dimethylpropan-1-amine,formic acid |
|---|
| Boiling Point | 604.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H30ClN3O5S |
| Molecular Weight | 496.01900 |
| Flash Point | 319.5ºC |
| Exact Mass | 495.15900 |
| PSA | 107.89000 |
| LogP | 4.61290 |
| InChIKey | HQUNJTQGOYQYMO-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)OCCS(=O)(=O)c1ccc(N2CCC(c3ccc(Cl)cc3)=N2)cc1.O=CO |