Benzenecarbo(dithioperoxo)thioicacid, 4-methoxy-, 1,1-dimethylethyl ester structure
|
Common Name | Benzenecarbo(dithioperoxo)thioicacid, 4-methoxy-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 68409-51-8 | Molecular Weight | 272.45000 | |
| Density | 1.182g/cm3 | Boiling Point | 373.8ºC at 760mmHg | |
| Molecular Formula | C12H16OS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.9ºC | |
| Name | tert-butylsulfanyl 4-methoxybenzenecarbodithioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.182g/cm3 |
|---|---|
| Boiling Point | 373.8ºC at 760mmHg |
| Molecular Formula | C12H16OS3 |
| Molecular Weight | 272.45000 |
| Flash Point | 179.9ºC |
| Exact Mass | 272.03600 |
| PSA | 91.92000 |
| LogP | 4.55060 |
| Index of Refraction | 1.612 |
| InChIKey | KQWJARLLMHFDEL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=S)SSC(C)(C)C)cc1 |
|
~%
Benzenecarbo(di... CAS#:68409-51-8 |
| Literature: Aycock,D.F.; Jurch,G.R. Journal of Organic Chemistry, 1979 , vol. 44, # 4 p. 569 - 572 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| tert-Butyl-trithioanisylperformat |