N-anilino-N-(4-nitrophenyl)imino-ethanimidamide structure
|
Common Name | N-anilino-N-(4-nitrophenyl)imino-ethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 68420-26-8 | Molecular Weight | 283.285 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 441.7±47.0 °C at 760 mmHg | |
| Molecular Formula | C14H13N5O2 | Melting Point | 160ºC | |
| MSDS | N/A | Flash Point | 220.9±29.3 °C | |
| Name | 1-(4-Nitrophenyl)-3-methyl-5-phenylformazan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.7±47.0 °C at 760 mmHg |
| Melting Point | 160ºC |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.285 |
| Flash Point | 220.9±29.3 °C |
| Exact Mass | 283.106934 |
| PSA | 94.93000 |
| LogP | 4.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | FHIGZTOTTOEVNT-DNTUAUKYSA-N |
| SMILES | CC(N=Nc1ccc([N+](=O)[O-])cc1)=NNc1ccccc1 |
| RIDADR | UN 1325 4.1/PG 3 |
|---|---|
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Ethanone, 1-[(E)-2-(4-nitrophenyl)diazenyl]-, 2-phenylhydrazone, (1E)- |
| 1-(4-nitrophenyl)-3-methyl-5-phenylformazan |
| (E)-1-(4-Nitrophenyl)-2-[(1E)-N-phenylethanehydrazonoyl]diazene |