1-amino-5-methyl-5,6,7,8,9,10-hexahydroanthracene-9,10-diol structure
|
Common Name | 1-amino-5-methyl-5,6,7,8,9,10-hexahydroanthracene-9,10-diol | ||
|---|---|---|---|---|
| CAS Number | 68450-03-3 | Molecular Weight | 245.31700 | |
| Density | 1.27g/cm3 | Boiling Point | 465.5ºC at 760 mmHg | |
| Molecular Formula | C15H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | 5-amino-1-methyl-1,2,3,4,9,10-hexahydroanthracene-9,10-diol |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 465.5ºC at 760 mmHg |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.31700 |
| Flash Point | 235.4ºC |
| Exact Mass | 245.14200 |
| PSA | 66.48000 |
| LogP | 3.04700 |
| Index of Refraction | 1.65 |
| InChIKey | MCDCWSCFBGBCNF-UHFFFAOYSA-N |
| SMILES | CC1CCCC2=C1C(O)c1cccc(N)c1C2O |
|
~%
1-amino-5-methy... CAS#:68450-03-3 |
| Literature: Oda,N. et al. Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 8 p. 2578 - 2581 |
|
~%
1-amino-5-methy... CAS#:68450-03-3 |
| Literature: Oda,N. et al. Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 8 p. 2578 - 2581 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |