2-methylprop-1-ene,phenol,2,4,4-trimethylpent-2-ene structure
|
Common Name | 2-methylprop-1-ene,phenol,2,4,4-trimethylpent-2-ene | ||
|---|---|---|---|---|
| CAS Number | 68457-76-1 | Molecular Weight | 262.43000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylprop-1-ene,phenol,2,4,4-trimethylpent-2-ene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H30O |
|---|---|
| Molecular Weight | 262.43000 |
| Exact Mass | 262.23000 |
| PSA | 20.23000 |
| LogP | 5.97330 |
| InChIKey | GZQSDZURPWPHHN-UHFFFAOYSA-N |
| SMILES | C=C(C)C.CC(C)=CC(C)(C)C.Oc1ccccc1 |
| Phenol,reaction products with isobutylene and 2,2,4-trimethylpentene |
| EINECS 270-607-5 |