6-chloro-1,2-dihydro-2,2,4-trimethylquinoline structure
|
Common Name | 6-chloro-1,2-dihydro-2,2,4-trimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 6848-16-4 | Molecular Weight | 207.69900 | |
| Density | 1.07g/cm3 | Boiling Point | 303ºC at 760 mmHg | |
| Molecular Formula | C12H14ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.1ºC | |
| Name | 6-chloro-2,2,4-trimethyl-1H-quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 303ºC at 760 mmHg |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.69900 |
| Flash Point | 137.1ºC |
| Exact Mass | 207.08100 |
| PSA | 12.03000 |
| LogP | 4.08540 |
| Index of Refraction | 1.534 |
| InChIKey | XQGISKQNLSPHNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)Nc2ccc(Cl)cc21 |
| HS Code | 2933499090 |
|---|
|
~76%
6-chloro-1,2-di... CAS#:6848-16-4 |
| Literature: Li, Yongshu; Wu, Chunlei; Huang, Jianliang; Su, Weike Synthetic Communications, 2006 , vol. 36, # 20 p. 3065 - 3073 |
|
~75%
6-chloro-1,2-di... CAS#:6848-16-4 |
| Literature: Ranu, Brindaban C.; Hajra, Alakananda; Dey, Suvendu S.; Jana, Umasish Tetrahedron, 2003 , vol. 59, # 6 p. 813 - 819 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-Chloro-1,2-dihydro-2,2,4-trimethylquinoline |
| 1,2-Dihydro-2,2,4-trimethyl-6-chlorchinolin |
| 6-Chlor-2,2,4-trimethyl-1,2-dihydro-chinolin |
| 6-chloro-2,2,4-trimethyl-1,2-dihydro-quinoline |
| EINECS 229-937-5 |