6-(Methylsulfonyl)uracil structure
|
Common Name | 6-(Methylsulfonyl)uracil | ||
|---|---|---|---|---|
| CAS Number | 6851-33-8 | Molecular Weight | 190.17700 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H6N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methylsulfonyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Molecular Formula | C5H6N2O4S |
| Molecular Weight | 190.17700 |
| Exact Mass | 190.00500 |
| PSA | 108.24000 |
| Index of Refraction | 1.591 |
| InChIKey | IBABLMOBNCGAMS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(=O)[nH]c(=O)[nH]1 |
|
~%
6-(Methylsulfon... CAS#:6851-33-8 |
| Literature: Greenbaum Journal of the American Chemical Society, 1954 , vol. 76, p. 6052 |
|
~%
6-(Methylsulfon... CAS#:6851-33-8 |
| Literature: Greenbaum Journal of the American Chemical Society, 1954 , vol. 76, p. 6052 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-(methylsulfonyl)pyrimidine-2,4(1h,3h)-dione |
| 6-methanesulfonyl-1H-pyrimidine-2,4-dione |
| Uracil,6-(methylsulfonyl) |
| 6-(Methylsulfonyl)uracil |
| Uracil-6-methylsulfon |
| 6-Methansulfonyl-1H-pyrimidin-2,4-dion |