1,2-bis(ethenyl)benzene,2-methylbuta-1,3-diene,prop-2-enenitrile structure
|
Common Name | 1,2-bis(ethenyl)benzene,2-methylbuta-1,3-diene,prop-2-enenitrile | ||
|---|---|---|---|---|
| CAS Number | 68511-52-4 | Molecular Weight | 251.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2-bis(ethenyl)benzene,2-methylbuta-1,3-diene,prop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21N |
|---|---|
| Molecular Weight | 251.36600 |
| Exact Mass | 251.16700 |
| PSA | 23.79000 |
| LogP | 5.41708 |
| InChIKey | LJONQCZWSATBMW-UHFFFAOYSA-N |
| SMILES | C=CC#N.C=CC(=C)C.C=Cc1ccccc1C=C |
| 2-Propenenitrile,polymer with diethenylbenzene and 2-methyl-1,3-butadiene,hydrolyzed |
| 2-Propenenitrile,2-methyl-1,3-butadiene,diethenylbenzene polymer,hydrolyzed |