formaldehyde,1-phenylethanone,thiourea structure
|
Common Name | formaldehyde,1-phenylethanone,thiourea | ||
|---|---|---|---|---|
| CAS Number | 68527-49-1 | Molecular Weight | 226.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | formaldehyde,1-phenylethanone,thiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H14N2O2S |
|---|---|
| Molecular Weight | 226.29500 |
| Exact Mass | 226.07800 |
| PSA | 122.81000 |
| LogP | 2.94990 |
| InChIKey | WDOWKZLZPNDUPA-UHFFFAOYSA-N |
| SMILES | C=O.CC(=O)c1ccccc1.NC(N)=S |
| thiourea |
| Thiourea,polymer with formaldehyde and 1-phenylethanone |
| Acetophenone,thiourea,formaldehyde polymer |