5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile
5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile structure
|
Common Name | 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 68534-36-1 | Molecular Weight | 280.10600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7Cl2NO2 |
|---|---|
| Molecular Weight | 280.10600 |
| Exact Mass | 278.98500 |
| PSA | 53.25000 |
| LogP | 4.36298 |
| InChIKey | VGWJFOZRUMFTLJ-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(Cl)ccc1Oc1ccc(Cl)c(O)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-chloro-2-(4-c... CAS#:68534-36-1 |
| Literature: CIBA-GEIGY AG Patent: DE2809541 , 1978 ; Chem.Abstr., 1979 , vol. 90, # 38691 |
|
~%
5-chloro-2-(4-c... CAS#:68534-36-1 |
| Literature: CIBA-GEIGY AG Patent: DE2809541 , 1978 ; Chem.Abstr., 1979 , vol. 90, # 38691 |
|
~%
5-chloro-2-(4-c... CAS#:68534-36-1 |
| Literature: CIBA-GEIGY AG Patent: DE2809541 , 1978 ; Chem.Abstr., 1979 , vol. 90, # 38691 |
|
~%
5-chloro-2-(4-c... CAS#:68534-36-1 |
| Literature: CIBA-GEIGY AG Patent: DE2809541 , 1978 ; Chem.Abstr., 1979 , vol. 90, # 38691 |
|
~%
5-chloro-2-(4-c... CAS#:68534-36-1 |
| Literature: CIBA-GEIGY AG Patent: DE2809541 , 1978 ; Chem.Abstr., 1979 , vol. 90, # 38691 |
![[3-(4-chloro-2-cyanophenoxy)phenyl] acetate structure](https://image.chemsrc.com/caspic/074/68534-34-9.png)
![[2-chloro-5-(4-chloro-2-cyanophenoxy)phenyl] acetate structure](https://image.chemsrc.com/caspic/026/68534-35-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: Related upstream materials(CAS) of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile: 21663-61-6;68534-34-9;68534-33-8;108-46-3;68534-35-0. |
| Q: What is the English name of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: The English name of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile. |
| Q: What is the polar surface area (PSA) of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: Polar surface area (PSA) of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is 53.25000. |
| Q: What is the CAS number of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: CAS number of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is 68534-36-1. |
| Q: What is the molecular formula of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: Molecular formula of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is C13H7Cl2NO2. |
| Q: What is the molecular weight of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: Molecular weight of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is 280.10600. |
| Q: What is the SMILES notation of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: SMILES notation of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is N#Cc1cc(Cl)ccc1Oc1ccc(Cl)c(O)c1. |
| Q: What is the Chinese name of 68534-36-1? |
| A: Chinese name of 68534-36-1 is 68534-36-1. |
| Q: What is the LogP of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: LogP of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is 4.36298. |
| Q: What is the InChIKey of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile? |
| A: InChIKey of 5-chloro-2-(4-chloro-3-hydroxyphenoxy)benzonitrile is VGWJFOZRUMFTLJ-UHFFFAOYSA-N. |