6-methyl-5-[(6-oxocyclohexa-2,4-dien-1-ylidene)amino]-2,4-dihydro-1H-1,2,4-triazin-3-one structure
|
Common Name | 6-methyl-5-[(6-oxocyclohexa-2,4-dien-1-ylidene)amino]-2,4-dihydro-1H-1,2,4-triazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 685551-55-7 | Molecular Weight | 218.21200 | |
| Density | 1.463g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-5-[(6-oxocyclohexa-2,4-dien-1-ylidene)amino]-2,4-dihydro-1H-1,2,4-triazin-3-one |
|---|
| Density | 1.463g/cm3 |
|---|---|
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21200 |
| Exact Mass | 218.08000 |
| PSA | 90.90000 |
| LogP | 0.99550 |
| Index of Refraction | 1.694 |
| InChIKey | ZJSAINOYLVWGGA-UHFFFAOYSA-N |
| SMILES | Cc1n[nH]c(=O)nc1Nc1ccccc1O |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |