bis-MPA-OH dendrimer structure
|
Common Name | bis-MPA-OH dendrimer | ||
|---|---|---|---|---|
| CAS Number | 685901-24-0 | Molecular Weight | 1179.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C51H86O30 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | bis-MPA-OH dendrimer trimethylol propane core, generation 2 |
|---|
| Molecular Formula | C51H86O30 |
|---|---|
| Molecular Weight | 1179.21 |
| Appearance of Characters | powder |
| InChIKey | JPMXKQHBVULZDX-UHFFFAOYSA-N |
| SMILES | CCC(COC(=O)C(C)(COC(=O)C(C)(CO)CO)COC(=O)C(C)(CO)CO)(COC(=O)C(C)(COC(=O)C(C)(CO)CO)COC(=O)C(C)(CO)CO)COC(=O)C(C)(COC(=O)C(C)(CO)CO)COC(=O)C(C)(CO)CO |
| Storage condition | -20°C |
| RIDADR | NONH for all modes of transport |
|---|
|
Dendritic architectures based on bis-MPA: functional polymeric scaffolds for application-driven research.
Chem. Soc. Rev. 42(13) , 5858-79, (2013) Dendritic polymers are highly branched, globular architectures with multiple representations of functional groups. These nanoscale organic frameworks continue to fascinate researchers worldwide and ar... |