2-(4-chlorosulfonyl)benzoyl)benzoicacid structure
|
Common Name | 2-(4-chlorosulfonyl)benzoyl)benzoicacid | ||
|---|---|---|---|---|
| CAS Number | 68592-12-1 | Molecular Weight | 359.181 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 584.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H8Cl2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.3±30.1 °C | |
| Name | 2-(4-Chloro-3-(chlorosulfonyl)benzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 584.5±50.0 °C at 760 mmHg |
| Molecular Formula | C14H8Cl2O5S |
| Molecular Weight | 359.181 |
| Flash Point | 307.3±30.1 °C |
| Exact Mass | 357.946960 |
| PSA | 96.89000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | PYSORILUZXWKON-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1 |
| HS Code | 2918300090 |
|---|
|
~%
2-(4-chlorosulf... CAS#:68592-12-1 |
| Literature: Helvetica Chimica Acta, , vol. 42, p. 1085,1086 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzoic acid, 2-[4-chloro-3-(chlorosulfonyl)benzoyl]- |
| 2-(4-chloro-3-chlorosulfonylbenzoyl)benzoic acid |
| 2-[4-Chloro-3-(chlorosulfonyl)benzoyl]benzoic acid |
| 2-(4-chlorosulfonyl)benzoyl)benzoicacid |