4-[2-(4-sulfamoylphenoxy)ethoxy]benzenesulfonamide structure
|
Common Name | 4-[2-(4-sulfamoylphenoxy)ethoxy]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 68641-71-4 | Molecular Weight | 372.41700 | |
| Density | 1.453g/cm3 | Boiling Point | 651.7ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.9ºC | |
| Name | 4-[2-(4-sulfamoylphenoxy)ethoxy]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 651.7ºC at 760 mmHg |
| Molecular Formula | C14H16N2O6S2 |
| Molecular Weight | 372.41700 |
| Flash Point | 347.9ºC |
| Exact Mass | 372.04500 |
| PSA | 155.54000 |
| LogP | 4.00140 |
| Index of Refraction | 1.612 |
| InChIKey | OZBAIJFKBCDSST-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(OCCOc2ccc(S(N)(=O)=O)cc2)cc1 |
|
~%
4-[2-(4-sulfamo... CAS#:68641-71-4 |
| Literature: Huntress; Carten Journal of the American Chemical Society, 1940 , vol. 62, p. 603 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4,4'-Aethandiyldioxy-bis-benzolsulfonsaeure-diamid |
| 4,4'-ethanediyldioxy-bis-benzenesulfonic acid diamide |
| 4,4'-[ethane-1,2-diylbis(oxy)]dibenzenesulfonamide |