3-Dehydroyohimbine
Modify Date: 2026-07-16 19:15:52
3-Dehydroyohimbine structure
|
Common Name | 3-Dehydroyohimbine | ||
|---|---|---|---|---|
| CAS Number | 6872-97-5 | Molecular Weight | 354.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Dehydroyohimbine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H26N2O3 |
|---|---|
| Molecular Weight | 354.4 |
| InChIKey | QVDHHVASSXBMRV-SCYLSFHTSA-O |
| SMILES | COC(=O)C1C([O-])CCC2C[NH+]3CCc4c([nH]c5ccccc45)C3CC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Dehydroyohimbine? |
| A: InChIKey of 3-Dehydroyohimbine is QVDHHVASSXBMRV-SCYLSFHTSA-O. |
| Q: What is the CAS number of 3-Dehydroyohimbine? |
| A: CAS number of 3-Dehydroyohimbine is 6872-97-5. |
| Q: What is the molecular formula of 3-Dehydroyohimbine? |
| A: Molecular formula of 3-Dehydroyohimbine is C21H26N2O3. |
| Q: What is the SMILES notation of 3-Dehydroyohimbine? |
| A: SMILES notation of 3-Dehydroyohimbine is COC(=O)C1C([O-])CCC2C[NH+]3CCc4c([nH]c5ccccc45)C3CC21. |
| Q: What is the molecular weight of 3-Dehydroyohimbine? |
| A: Molecular weight of 3-Dehydroyohimbine is 354.4. |
| Q: What is the English name of 3-Dehydroyohimbine? |
| A: The English name of 3-Dehydroyohimbine is 3-Dehydroyohimbine. |
| Q: What is the Chinese name of 6872-97-5? |
| A: Chinese name of 6872-97-5 is 6872-97-5. |