Benzenesulfonamide,4,4'-[1,2-ethanediylbis(oxy)]bis[N,N-dimethyl- (9CI) structure
|
Common Name | Benzenesulfonamide,4,4'-[1,2-ethanediylbis(oxy)]bis[N,N-dimethyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 68732-12-7 | Molecular Weight | 428.52300 | |
| Density | 1.3g/cm3 | Boiling Point | 594.2ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.2ºC | |
| Name | sodium,3-(1,3-benzoxazol-2-ylsulfanyl)propane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 594.2ºC at 760 mmHg |
| Molecular Formula | C18H24N2O6S2 |
| Molecular Weight | 428.52300 |
| Flash Point | 313.2ºC |
| Exact Mass | 428.10800 |
| PSA | 109.98000 |
| LogP | 3.80660 |
| Index of Refraction | 1.57 |
| InChIKey | SRHGDRUNEXTHOL-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCOc2ccc(S(=O)(=O)N(C)C)cc2)cc1 |
|
~%
Benzenesulfonam... CAS#:68732-12-7 |
| Literature: King Journal of the American Chemical Society, 1944 , vol. 66, p. 2076,2079 |
|
~%
Benzenesulfonam... CAS#:68732-12-7 |
| Literature: King Journal of the American Chemical Society, 1944 , vol. 66, p. 2076,2079 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| AmbscPOD_04/0403 |
| EINECS 268-000-5 |
| 4,4'-Aethandiyldioxy-bis-benzolsulfonsaeure-bis-dimethylamid |
| 4,4'-ethanediyldioxy-bis-benzenesulfonic acid bis-dimethylamide |