p-nitrobenzyl 5-methylthiazole-4-carboxylate
p-nitrobenzyl 5-methylthiazole-4-carboxylate structure
|
Common Name | p-nitrobenzyl 5-methylthiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 68751-06-4 | Molecular Weight | 278.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: p-Nitrobenzyl 5-methylthiazole-4-carboxylate (CAS: 68751-06-4), molecular formula C12H10N2O4S, molecular weight 278.28400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | p-nitrobenzyl 5-methylthiazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N2O4S |
|---|---|
| Molecular Weight | 278.28400 |
| Exact Mass | 278.03600 |
| PSA | 113.25000 |
| LogP | 3.23990 |
| InChIKey | FEFMGKFRBDGGFN-UHFFFAOYSA-N |
| SMILES | Cc1scnc1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-methyl-thiazole-4-carboxylic acid 4-nitro-benzyl ester |
| p-Nirobenzyl-5-methylthiazol-4-carboxylat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: SMILES notation of p-nitrobenzyl 5-methylthiazole-4-carboxylate is Cc1scnc1C(=O)OCc1ccc([N+](=O)[O-])cc1. |
| Q: What is the Chinese name of 68751-06-4? |
| A: Chinese name of 68751-06-4 is 68751-06-4. |
| Q: What is the LogP of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: LogP of p-nitrobenzyl 5-methylthiazole-4-carboxylate is 3.23990. |
| Q: What is the English name of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: The English name of p-nitrobenzyl 5-methylthiazole-4-carboxylate is p-nitrobenzyl 5-methylthiazole-4-carboxylate. |
| Q: What is the polar surface area (PSA) of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: Polar surface area (PSA) of p-nitrobenzyl 5-methylthiazole-4-carboxylate is 113.25000. |
| Q: What is the InChIKey of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: InChIKey of p-nitrobenzyl 5-methylthiazole-4-carboxylate is FEFMGKFRBDGGFN-UHFFFAOYSA-N. |
| Q: What is the CAS number of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: CAS number of p-nitrobenzyl 5-methylthiazole-4-carboxylate is 68751-06-4. |
| Q: What English synonyms does p-nitrobenzyl 5-methylthiazole-4-carboxylate have? |
| A: English synonyms of p-nitrobenzyl 5-methylthiazole-4-carboxylate: 5-methyl-thiazole-4-carboxylic acid 4-nitro-benzyl ester, p-Nirobenzyl-5-methylthiazol-4-carboxylat. |
| Q: What is the molecular weight of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: Molecular weight of p-nitrobenzyl 5-methylthiazole-4-carboxylate is 278.28400. |
| Q: What is the molecular formula of p-nitrobenzyl 5-methylthiazole-4-carboxylate? |
| A: Molecular formula of p-nitrobenzyl 5-methylthiazole-4-carboxylate is C12H10N2O4S. |