2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol structure
|
Common Name | 2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol | ||
|---|---|---|---|---|
| CAS Number | 68751-57-5 | Molecular Weight | 342.01300 | |
| Density | 1.628g/cm3 | Boiling Point | 429.498ºC at 760 mmHg | |
| Molecular Formula | C11H11BrCl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.553ºC | |
| Name | [2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.628g/cm3 |
|---|---|
| Boiling Point | 429.498ºC at 760 mmHg |
| Molecular Formula | C11H11BrCl2O3 |
| Molecular Weight | 342.01300 |
| Flash Point | 213.553ºC |
| Exact Mass | 339.92700 |
| PSA | 38.69000 |
| LogP | 2.94880 |
| Index of Refraction | 1.579 |
| InChIKey | KWVAKSFLLNZGBK-UHFFFAOYSA-N |
| SMILES | OCC1COC(CBr)(c2ccc(Cl)cc2Cl)O1 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2,4-dichlorophenyl)-2-bromomethyl-4-hydroxymethyl-1,3-dioxolane |
| 1,3-Dioxolane-4-methanol,2-(bromomethyl)-2-(2,4-dichlorophenyl) |
| 2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol |
| (2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl)methanol |
| 2-bromomethyl-2-(2,4-dichlorophenyl)-4-hydroxymethyl-1,3-dioxolane |