2-[4,6-bis(2-cyanophenyl)-1,3,5-triazin-2-yl]benzonitrile structure
|
Common Name | 2-[4,6-bis(2-cyanophenyl)-1,3,5-triazin-2-yl]benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 6876-33-1 | Molecular Weight | 384.39200 | |
| Density | 1.396g/cm3 | Boiling Point | 741.039ºC at 760 mmHg | |
| Molecular Formula | C24H12N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.709ºC | |
| Name | 2-[4,6-bis(2-cyanophenyl)-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 741.039ºC at 760 mmHg |
| Molecular Formula | C24H12N6 |
| Molecular Weight | 384.39200 |
| Flash Point | 203.709ºC |
| Exact Mass | 384.11200 |
| PSA | 110.04000 |
| LogP | 4.48764 |
| Index of Refraction | 1.713 |
| InChIKey | MBRLIGRTTVARHE-UHFFFAOYSA-N |
| SMILES | N#Cc1ccccc1-c1nc(-c2ccccc2C#N)nc(-c2ccccc2C#N)n1 |
|
~%
2-[4,6-bis(2-cy... CAS#:6876-33-1 |
| Literature: Ross; Fineman Journal of the American Chemical Society, 1950 , vol. 72, p. 3302 |
|
~%
2-[4,6-bis(2-cy... CAS#:6876-33-1 |
| Literature: Janczak, Jan; Kubiak, Ryszard Acta Chemica Scandinavica, 1999 , vol. 53, # 8 p. 602 - 610 |
|
~%
2-[4,6-bis(2-cy... CAS#:6876-33-1 |
| Literature: Tomoda, Haruhiko; Saito, Shojiro; Ogawa, Shojiro; Shiraishi, Shinsaku Chemistry Letters, 1980 , p. 1277 - 1280 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,4,6-Tri-<o-cyano-phenyl>-1,3,5-triazin |