Tuberstemonine structure
|
Common Name | Tuberstemonine | ||
|---|---|---|---|---|
| CAS Number | 6879-01-2 | Molecular Weight | 375.502 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 554.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H33NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.0±30.1 °C | |
Use of TuberstemonineTuberstemonine, an alkaloid, is an antimalarial agent that targets Plasmodium falciparum ferredoxin-NADP+ reductases (pfFNR)[1]. |
| Name | tuberostemonine |
|---|---|
| Synonym | More Synonyms |
| Description | Tuberstemonine, an alkaloid, is an antimalarial agent that targets Plasmodium falciparum ferredoxin-NADP+ reductases (pfFNR)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 554.2±50.0 °C at 760 mmHg |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.502 |
| Flash Point | 289.0±30.1 °C |
| Exact Mass | 375.240967 |
| PSA | 55.84000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | GYOGHROCTSEKDY-JJDZUBOLSA-N |
| SMILES | CCC1C2CCCCN3C(C4CC(C)C(=O)O4)CC(C4C(C)C(=O)OC14)C23 |
| Storage condition | 2-8C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (2S,7aR,8R,8aS,11S,11aS,11bR,11cR)-8-Ethyl-11-methyl-2-[(2S,4S)-4-methyl-5-oxotetrahydrofuran-2-yl]dodecahydroazepino[3,2,1-hi]furo[3,2-e]indol-10(2H)-one |
| TuberosteMonin |
| Tuberstemonine |
| (2S,7aR,8R,8aS,11S,11aS,11bR,11cR)-8-Ethyl-11-methyl-2-[(2S,4S)-4-methyl-5-oxotetrahydro-2-furanyl]dodecahydroazepino[3,2,1-hi]furo[3,2-e]indol-10(2H)-one |