dinonylnaphthalenesulphonic acid, compound with 2-(dimethylamino)-2-methylpropan-1-ol (1:1) structure
|
Common Name | dinonylnaphthalenesulphonic acid, compound with 2-(dimethylamino)-2-methylpropan-1-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68833-68-1 | Molecular Weight | 577.90156 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H59NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dinonylnaphthalenesulphonic acid, compound with 2-(dimethylamino)-2-methylpropan-1-ol (1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H59NO4S |
|---|---|
| Molecular Weight | 577.90156 |
| InChIKey | DNJPBQWXLLMHGT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCc1ccc2c(S(=O)(=O)O)cc(CCCCCCCCC)cc2c1.CN(C)C(C)(C)CO |
| EINECS 272-411-5 |